C27H43N2P — CID 154703036
ditert-butyl-[[4-tert-butyl-6-(4-tert-butyl-2-pyridinyl)-2-pyridinyl]methyl]phosphane (PubChem CID 154703036) has the molecular formula C27H43N2P and a molecular weight of 426.63 g/mol. Its IUPAC name is ditert-butyl-[[4-tert-butyl-6-(4-tert-butyl-2-pyridinyl)-2-pyridinyl]methyl]phosphane.
| Compound Name | ditert-butyl-[[4-tert-butyl-6-(4-tert-butyl-2-pyridinyl)-2-pyridinyl]methyl]phosphane |
|---|---|
| PubChem CID | 154703036 |
| Molecular Formula | C27H43N2P |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.32 |
| IUPAC Name | ditert-butyl-[[4-tert-butyl-6-(4-tert-butyl-2-pyridinyl)-2-pyridinyl]methyl]phosphane |
| SMILES | CC(C)(C)c1ccnc(-c2cc(C(C)(C)C)cc(CP(C(C)(C)C)C(C)(C)C)n2)c1 |
| InChI | InChI=1S/C27H43N2P/c1-24(2,3)19-13-14-28-22(16-19)23-17-20(25(4,5)6)15-21(29-23)18-30(26(7,8)9)27(10,11)12/h13-17H,18H2,1-12H3 |
| InChIKey | XJQHPPVSXIASQO-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|