C14H15ClN2 — CID 156780767
2-(4-tert-butyl-2-pyridinyl)-6-chloropyridine (PubChem CID 156780767) has the molecular formula C14H15ClN2 and a molecular weight of 246.74 g/mol. Its IUPAC name is 2-(4-tert-butyl-2-pyridinyl)-6-chloropyridine.
| Compound Name | 2-(4-tert-butyl-2-pyridinyl)-6-chloropyridine |
|---|---|
| PubChem CID | 156780767 |
| Molecular Formula | C14H15ClN2 |
| Molecular Weight | 246.74 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 2-(4-tert-butyl-2-pyridinyl)-6-chloropyridine |
| SMILES | CC(C)(C)c1ccnc(-c2cccc(Cl)n2)c1 |
| InChI | InChI=1S/C14H15ClN2/c1-14(2,3)10-7-8-16-12(9-10)11-5-4-6-13(15)17-11/h4-9H,1-3H3 |
| InChIKey | COFIVKWTOLETRU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.74 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|