C18H30O10S2 — CID 11858857
diethyl (2E,6S,7S,10E)-6,7-bis(methylsulfonyloxy)dodeca-2,10-dienedioate (PubChem CID 11858857) has the molecular formula C18H30O10S2 and a molecular weight of 470.56 g/mol. Its IUPAC name is diethyl (2E,6S,7S,10E)-6,7-bis(methylsulfonyloxy)dodeca-2,10-dienedioate.
| Compound Name | diethyl (2E,6S,7S,10E)-6,7-bis(methylsulfonyloxy)dodeca-2,10-dienedioate |
|---|---|
| PubChem CID | 11858857 |
| Molecular Formula | C18H30O10S2 |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | diethyl (2E,6S,7S,10E)-6,7-bis(methylsulfonyloxy)dodeca-2,10-dienedioate |
| SMILES | CCOC(=O)/C=C/CC[C@H](OS(C)(=O)=O)[C@H](CC/C=C/C(=O)OCC)OS(C)(=O)=O |
| InChI | InChI=1S/C18H30O10S2/c1-5-25-17(19)13-9-7-11-15(27-29(3,21)22)16(28-30(4,23)24)12-8-10-14-18(20)26-6-2/h9-10,13-16H,5-8,11-12H2,1-4H3/b13-9+,14-10+/t15-,16-/m0/s1 |
| InChIKey | MEQGUGYNSJLZOK-YIQDACCSSA-N |
| XLogP | 1.48 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|