C18H30O7S — CID 134883452
diethyl (2E,11E)-7-methylsulfonyloxytrideca-2,11-dienedioate (PubChem CID 134883452) has the molecular formula C18H30O7S and a molecular weight of 390.50 g/mol. Its IUPAC name is diethyl (2E,11E)-7-methylsulfonyloxytrideca-2,11-dienedioate.
| Compound Name | diethyl (2E,11E)-7-methylsulfonyloxytrideca-2,11-dienedioate |
|---|---|
| PubChem CID | 134883452 |
| Molecular Formula | C18H30O7S |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | diethyl (2E,11E)-7-methylsulfonyloxytrideca-2,11-dienedioate |
| SMILES | CCOC(=O)/C=C/CCCC(CCC/C=C/C(=O)OCC)OS(C)(=O)=O |
| InChI | InChI=1S/C18H30O7S/c1-4-23-17(19)14-10-6-8-12-16(25-26(3,21)22)13-9-7-11-15-18(20)24-5-2/h10-11,14-16H,4-9,12-13H2,1-3H3/b14-10+,15-11+ |
| InChIKey | QZGZJVBOPNTAMP-WFYKWJGLSA-N |
| XLogP | 2.91 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|