C13H20F3N — CID 118588923
3,4,5-trifluoro-6-hexyl-5-methylcyclohexa-1,3-dien-1-amine (PubChem CID 118588923) has the molecular formula C13H20F3N and a molecular weight of 247.30 g/mol. Its IUPAC name is 3,4,5-trifluoro-6-hexyl-5-methylcyclohexa-1,3-dien-1-amine.
| Compound Name | 3,4,5-trifluoro-6-hexyl-5-methylcyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 118588923 |
| Molecular Formula | C13H20F3N |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | 3,4,5-trifluoro-6-hexyl-5-methylcyclohexa-1,3-dien-1-amine |
| SMILES | CCCCCCC1C(N)=CC(F)=C(F)C1(C)F |
| InChI | InChI=1S/C13H20F3N/c1-3-4-5-6-7-9-11(17)8-10(14)12(15)13(9,2)16/h8-9H,3-7,17H2,1-2H3 |
| InChIKey | FCPZZFUOXGBYPH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|