C19H23N3O3 — CID 118593217
tert-butyl 2-[(4,5-dimethylpyrimidin-2-yl)carbamoyl]-5-methylbenzoate (PubChem CID 118593217) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is tert-butyl 2-[(4,5-dimethylpyrimidin-2-yl)carbamoyl]-5-methylbenzoate.
| Compound Name | tert-butyl 2-[(4,5-dimethylpyrimidin-2-yl)carbamoyl]-5-methylbenzoate |
|---|---|
| PubChem CID | 118593217 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | tert-butyl 2-[(4,5-dimethylpyrimidin-2-yl)carbamoyl]-5-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Nc2ncc(C)c(C)n2)c(C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C19H23N3O3/c1-11-7-8-14(15(9-11)17(24)25-19(4,5)6)16(23)22-18-20-10-12(2)13(3)21-18/h7-10H,1-6H3,(H,20,21,22,23) |
| InChIKey | YSSWVZKGBGHDFU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |