C19H21BrN2O3 — CID 90303366
tert-butyl 4-bromo-2-[(5,6-dimethyl-2-pyridinyl)carbamoyl]benzoate (PubChem CID 90303366) has the molecular formula C19H21BrN2O3 and a molecular weight of 405.29 g/mol. Its IUPAC name is tert-butyl 4-bromo-2-[(5,6-dimethyl-2-pyridinyl)carbamoyl]benzoate.
| Compound Name | tert-butyl 4-bromo-2-[(5,6-dimethyl-2-pyridinyl)carbamoyl]benzoate |
|---|---|
| PubChem CID | 90303366 |
| Molecular Formula | C19H21BrN2O3 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | tert-butyl 4-bromo-2-[(5,6-dimethyl-2-pyridinyl)carbamoyl]benzoate |
| SMILES | Cc1ccc(NC(=O)c2cc(Br)ccc2C(=O)OC(C)(C)C)nc1C |
| InChI | InChI=1S/C19H21BrN2O3/c1-11-6-9-16(21-12(11)2)22-17(23)15-10-13(20)7-8-14(15)18(24)25-19(3,4)5/h6-10H,1-5H3,(H,21,22,23) |
| InChIKey | JJXKMOGOIFBCEG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |