C19H20ClF3N2O2S — CID 118595022
tert-butyl 4-[2-chloro-4-(2-sulfanylideneethylideneamino)-6-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 118595022) has the molecular formula C19H20ClF3N2O2S and a molecular weight of 432.90 g/mol. Its IUPAC name is tert-butyl 4-[2-chloro-4-(2-sulfanylideneethylideneamino)-6-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-chloro-4-(2-sulfanylideneethylideneamino)-6-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 118595022 |
| Molecular Formula | C19H20ClF3N2O2S |
| Molecular Weight | 432.90 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | tert-butyl 4-[2-chloro-4-(2-sulfanylideneethylideneamino)-6-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=C(c2c(Cl)cc(/N=C/C=S)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C19H20ClF3N2O2S/c1-18(2,3)27-17(26)25-7-4-12(5-8-25)16-14(19(21,22)23)10-13(11-15(16)20)24-6-9-28/h4,6,9-11H,5,7-8H2,1-3H3/b24-6+ |
| InChIKey | LXDWWLXSPUZAAY-GFXGDVFHSA-N |
| XLogP | 6.09 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.90 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|