C17H18Cl2N2O2S — CID 90390947
tert-butyl 4-(2,6-dichloro-4-isothiocyanatophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 90390947) has the molecular formula C17H18Cl2N2O2S and a molecular weight of 385.32 g/mol. Its IUPAC name is tert-butyl 4-(2,6-dichloro-4-isothiocyanatophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-(2,6-dichloro-4-isothiocyanatophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 90390947 |
| Molecular Formula | C17H18Cl2N2O2S |
| Molecular Weight | 385.32 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | tert-butyl 4-(2,6-dichloro-4-isothiocyanatophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=C(c2c(Cl)cc(N=C=S)cc2Cl)CC1 |
| InChI | InChI=1S/C17H18Cl2N2O2S/c1-17(2,3)23-16(22)21-6-4-11(5-7-21)15-13(18)8-12(20-10-24)9-14(15)19/h4,8-9H,5-7H2,1-3H3 |
| InChIKey | URSWWAOSOMXUIL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.32 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|