C15H13Cl2N5 — CID 118596411
5-quinolin-3-yl-7H-pyrrolo[2,3-d]pyrimidin-4-amine;dihydrochloride (PubChem CID 118596411) has the molecular formula C15H13Cl2N5 and a molecular weight of 334.21 g/mol. Its IUPAC name is 5-quinolin-3-yl-7H-pyrrolo[2,3-d]pyrimidin-4-amine;dihydrochloride.
| Compound Name | 5-quinolin-3-yl-7H-pyrrolo[2,3-d]pyrimidin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 118596411 |
| Molecular Formula | C15H13Cl2N5 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 5-quinolin-3-yl-7H-pyrrolo[2,3-d]pyrimidin-4-amine;dihydrochloride |
| SMILES | Cl.Cl.Nc1ncnc2[nH]cc(-c3cnc4ccccc4c3)c12 |
| InChI | InChI=1S/C15H11N5.2ClH/c16-14-13-11(7-18-15(13)20-8-19-14)10-5-9-3-1-2-4-12(9)17-6-10;;/h1-8H,(H3,16,18,19,20);2*1H |
| InChIKey | WFVUIACUCHUYJS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |