C17H13N3 — CID 67500514
3-(3-methyl-1H-pyrrolo[2,3-b]pyridin-4-yl)quinoline (PubChem CID 67500514) has the molecular formula C17H13N3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 3-(3-methyl-1H-pyrrolo[2,3-b]pyridin-4-yl)quinoline.
| Compound Name | 3-(3-methyl-1H-pyrrolo[2,3-b]pyridin-4-yl)quinoline |
|---|---|
| PubChem CID | 67500514 |
| Molecular Formula | C17H13N3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 3-(3-methyl-1H-pyrrolo[2,3-b]pyridin-4-yl)quinoline |
| SMILES | Cc1c[nH]c2nccc(-c3cnc4ccccc4c3)c12 |
| InChI | InChI=1S/C17H13N3/c1-11-9-20-17-16(11)14(6-7-18-17)13-8-12-4-2-3-5-15(12)19-10-13/h2-10H,1H3,(H,18,20) |
| InChIKey | UOVPGZXUCNFVJQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |