C21H21ClN6O3 — CID 118596896
1-[2-[4-(2-amino-5-chloro-3-pyridinyl)phenoxy]pyrimidin-5-yl]-3-(oxan-4-yl)urea (PubChem CID 118596896) has the molecular formula C21H21ClN6O3 and a molecular weight of 440.89 g/mol. Its IUPAC name is 1-[2-[4-(2-amino-5-chloro-3-pyridinyl)phenoxy]pyrimidin-5-yl]-3-(oxan-4-yl)urea.
| Compound Name | 1-[2-[4-(2-amino-5-chloro-3-pyridinyl)phenoxy]pyrimidin-5-yl]-3-(oxan-4-yl)urea |
|---|---|
| PubChem CID | 118596896 |
| Molecular Formula | C21H21ClN6O3 |
| Molecular Weight | 440.89 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 1-[2-[4-(2-amino-5-chloro-3-pyridinyl)phenoxy]pyrimidin-5-yl]-3-(oxan-4-yl)urea |
| SMILES | Nc1ncc(Cl)cc1-c1ccc(Oc2ncc(NC(=O)NC3CCOCC3)cn2)cc1 |
| InChI | InChI=1S/C21H21ClN6O3/c22-14-9-18(19(23)24-10-14)13-1-3-17(4-2-13)31-21-25-11-16(12-26-21)28-20(29)27-15-5-7-30-8-6-15/h1-4,9-12,15H,5-8H2,(H2,23,24)(H2,27,28,29) |
| InChIKey | KWGIDGGCDSDOGU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 124.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.89 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |