C20H23N3O4 — CID 122076375
4-[[6-(4-methylphenoxy)-3-pyridinyl]carbamoylamino]cyclohexane-1-carboxylic acid (PubChem CID 122076375) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 4-[[6-(4-methylphenoxy)-3-pyridinyl]carbamoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[6-(4-methylphenoxy)-3-pyridinyl]carbamoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122076375 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 4-[[6-(4-methylphenoxy)-3-pyridinyl]carbamoylamino]cyclohexane-1-carboxylic acid |
| SMILES | Cc1ccc(Oc2ccc(NC(=O)NC3CCC(C(=O)O)CC3)cn2)cc1 |
| InChI | InChI=1S/C20H23N3O4/c1-13-2-9-17(10-3-13)27-18-11-8-16(12-21-18)23-20(26)22-15-6-4-14(5-7-15)19(24)25/h2-3,8-12,14-15H,4-7H2,1H3,(H,24,25)(H2,22,23,26) |
| InChIKey | NUQWCUYSHLOJIE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |