C18H18ClN3O4 — CID 122078011
1-[[6-(4-chlorophenoxy)-3-pyridinyl]carbamoyl]piperidine-4-carboxylic acid (PubChem CID 122078011) has the molecular formula C18H18ClN3O4 and a molecular weight of 375.81 g/mol. Its IUPAC name is 1-[[6-(4-chlorophenoxy)-3-pyridinyl]carbamoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[[6-(4-chlorophenoxy)-3-pyridinyl]carbamoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 122078011 |
| Molecular Formula | C18H18ClN3O4 |
| Molecular Weight | 375.81 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 1-[[6-(4-chlorophenoxy)-3-pyridinyl]carbamoyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)Nc2ccc(Oc3ccc(Cl)cc3)nc2)CC1 |
| InChI | InChI=1S/C18H18ClN3O4/c19-13-1-4-15(5-2-13)26-16-6-3-14(11-20-16)21-18(25)22-9-7-12(8-10-22)17(23)24/h1-6,11-12H,7-10H2,(H,21,25)(H,23,24) |
| InChIKey | JOYDKXQTXXHQOI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.81 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |