C18H19N3O4 — CID 122089479
1-[(5-phenoxy-2-pyridinyl)carbamoyl]piperidine-4-carboxylic acid (PubChem CID 122089479) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 1-[(5-phenoxy-2-pyridinyl)carbamoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(5-phenoxy-2-pyridinyl)carbamoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 122089479 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 1-[(5-phenoxy-2-pyridinyl)carbamoyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)Nc2ccc(Oc3ccccc3)cn2)CC1 |
| InChI | InChI=1S/C18H19N3O4/c22-17(23)13-8-10-21(11-9-13)18(24)20-16-7-6-15(12-19-16)25-14-4-2-1-3-5-14/h1-7,12-13H,8-11H2,(H,22,23)(H,19,20,24) |
| InChIKey | KIBFENDATXSFHP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |