C23H27ClN4O2 — CID 118597063
(6R)-6-[4-[2-(4-nitrophenyl)ethyl]piperazin-1-yl]-5,6,7,8-tetrahydronaphthalene-2-carbonitrile;hydrochloride (PubChem CID 118597063) has the molecular formula C23H27ClN4O2 and a molecular weight of 426.95 g/mol. Its IUPAC name is (6R)-6-[4-[2-(4-nitrophenyl)ethyl]piperazin-1-yl]-5,6,7,8-tetrahydronaphthalene-2-carbonitrile;hydrochloride.
| Compound Name | (6R)-6-[4-[2-(4-nitrophenyl)ethyl]piperazin-1-yl]-5,6,7,8-tetrahydronaphthalene-2-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 118597063 |
| Molecular Formula | C23H27ClN4O2 |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | (6R)-6-[4-[2-(4-nitrophenyl)ethyl]piperazin-1-yl]-5,6,7,8-tetrahydronaphthalene-2-carbonitrile;hydrochloride |
| SMILES | Cl.N#Cc1ccc2c(c1)CC[C@@H](N1CCN(CCc3ccc([N+](=O)[O-])cc3)CC1)C2 |
| InChI | InChI=1S/C23H26N4O2.ClH/c24-17-19-1-4-21-16-23(8-5-20(21)15-19)26-13-11-25(12-14-26)10-9-18-2-6-22(7-3-18)27(28)29;/h1-4,6-7,15,23H,5,8-14,16H2;1H/t23-;/m1./s1 |
| InChIKey | KZQANDFNDBRYHX-GNAFDRTKSA-N |
| XLogP | 3.61 |
| TPSA | 73.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|