C21H21ClN2 — CID 118600805
2-(3-chlorophenyl)-4-methyl-6-[(4-propylphenyl)methyl]pyrimidine (PubChem CID 118600805) has the molecular formula C21H21ClN2 and a molecular weight of 336.87 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-4-methyl-6-[(4-propylphenyl)methyl]pyrimidine.
| Compound Name | 2-(3-chlorophenyl)-4-methyl-6-[(4-propylphenyl)methyl]pyrimidine |
|---|---|
| PubChem CID | 118600805 |
| Molecular Formula | C21H21ClN2 |
| Molecular Weight | 336.87 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 2-(3-chlorophenyl)-4-methyl-6-[(4-propylphenyl)methyl]pyrimidine |
| SMILES | CCCc1ccc(Cc2cc(C)nc(-c3cccc(Cl)c3)n2)cc1 |
| InChI | InChI=1S/C21H21ClN2/c1-3-5-16-8-10-17(11-9-16)13-20-12-15(2)23-21(24-20)18-6-4-7-19(22)14-18/h4,6-12,14H,3,5,13H2,1-2H3 |
| InChIKey | BFLNNZVOMZKNDJ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.87 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |