C22H20ClNO — CID 118048453
1-[4-[[2-(3-chlorophenyl)-6-methyl-4-pyridinyl]methyl]phenyl]propan-2-one (PubChem CID 118048453) has the molecular formula C22H20ClNO and a molecular weight of 349.86 g/mol. Its IUPAC name is 1-[4-[[2-(3-chlorophenyl)-6-methyl-4-pyridinyl]methyl]phenyl]propan-2-one.
| Compound Name | 1-[4-[[2-(3-chlorophenyl)-6-methyl-4-pyridinyl]methyl]phenyl]propan-2-one |
|---|---|
| PubChem CID | 118048453 |
| Molecular Formula | C22H20ClNO |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 1-[4-[[2-(3-chlorophenyl)-6-methyl-4-pyridinyl]methyl]phenyl]propan-2-one |
| SMILES | CC(=O)Cc1ccc(Cc2cc(C)nc(-c3cccc(Cl)c3)c2)cc1 |
| InChI | InChI=1S/C22H20ClNO/c1-15-10-19(12-18-8-6-17(7-9-18)11-16(2)25)13-22(24-15)20-4-3-5-21(23)14-20/h3-10,13-14H,11-12H2,1-2H3 |
| InChIKey | OHQKSZFFYNGQAV-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |