C26H22FIN4O3 — CID 118601546
N-[[1-(2-fluorophenyl)-7-iodo-4-oxoquinolin-3-yl]methyl]-6-morpholin-4-ylpyridine-3-carboxamide (PubChem CID 118601546) has the molecular formula C26H22FIN4O3 and a molecular weight of 584.39 g/mol. Its IUPAC name is N-[[1-(2-fluorophenyl)-7-iodo-4-oxoquinolin-3-yl]methyl]-6-morpholin-4-ylpyridine-3-carboxamide.
| Compound Name | N-[[1-(2-fluorophenyl)-7-iodo-4-oxoquinolin-3-yl]methyl]-6-morpholin-4-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 118601546 |
| Molecular Formula | C26H22FIN4O3 |
| Molecular Weight | 584.39 g/mol |
| Exact Mass | 584.07 |
| IUPAC Name | N-[[1-(2-fluorophenyl)-7-iodo-4-oxoquinolin-3-yl]methyl]-6-morpholin-4-ylpyridine-3-carboxamide |
| SMILES | O=C(NCc1cn(-c2ccccc2F)c2cc(I)ccc2c1=O)c1ccc(N2CCOCC2)nc1 |
| InChI | InChI=1S/C26H22FIN4O3/c27-21-3-1-2-4-22(21)32-16-18(25(33)20-7-6-19(28)13-23(20)32)15-30-26(34)17-5-8-24(29-14-17)31-9-11-35-12-10-31/h1-8,13-14,16H,9-12,15H2,(H,30,34) |
| InChIKey | VESYIVYHVKLMRN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|