C25H25ClN4O3 — CID 118601565
7-chloro-N,N-dimethyl-3-[[[(2E)-2-(methylaminomethylidene)but-3-enoyl]amino]methyl]-4-oxo-1-phenylquinoline-2-carboxamide (PubChem CID 118601565) has the molecular formula C25H25ClN4O3 and a molecular weight of 464.95 g/mol. Its IUPAC name is 7-chloro-N,N-dimethyl-3-[[[(2E)-2-(methylaminomethylidene)but-3-enoyl]amino]methyl]-4-oxo-1-phenylquinoline-2-carboxamide.
| Compound Name | 7-chloro-N,N-dimethyl-3-[[[(2E)-2-(methylaminomethylidene)but-3-enoyl]amino]methyl]-4-oxo-1-phenylquinoline-2-carboxamide |
|---|---|
| PubChem CID | 118601565 |
| Molecular Formula | C25H25ClN4O3 |
| Molecular Weight | 464.95 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 7-chloro-N,N-dimethyl-3-[[[(2E)-2-(methylaminomethylidene)but-3-enoyl]amino]methyl]-4-oxo-1-phenylquinoline-2-carboxamide |
| SMILES | C=C/C(=C\NC)C(=O)NCc1c(C(=O)N(C)C)n(-c2ccccc2)c2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C25H25ClN4O3/c1-5-16(14-27-2)24(32)28-15-20-22(25(33)29(3)4)30(18-9-7-6-8-10-18)21-13-17(26)11-12-19(21)23(20)31/h5-14,27H,1,15H2,2-4H3,(H,28,32)/b16-14+ |
| InChIKey | YKAZTBMYXOYLFS-JQIJEIRASA-N |
| XLogP | 3.25 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.95 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|