C23H12BrN5O4 — CID 118602070
2-(5-bromo-1H-indol-3-yl)-5,10-dinitro-1H-phenanthro[9,10-d]imidazole (PubChem CID 118602070) has the molecular formula C23H12BrN5O4 and a molecular weight of 502.28 g/mol. Its IUPAC name is 2-(5-bromo-1H-indol-3-yl)-5,10-dinitro-1H-phenanthro[9,10-d]imidazole.
| Compound Name | 2-(5-bromo-1H-indol-3-yl)-5,10-dinitro-1H-phenanthro[9,10-d]imidazole |
|---|---|
| PubChem CID | 118602070 |
| Molecular Formula | C23H12BrN5O4 |
| Molecular Weight | 502.28 g/mol |
| Exact Mass | 501.01 |
| IUPAC Name | 2-(5-bromo-1H-indol-3-yl)-5,10-dinitro-1H-phenanthro[9,10-d]imidazole |
| SMILES | O=[N+]([O-])c1ccc2c3ccc([N+](=O)[O-])cc3c3[nH]c(-c4c[nH]c5ccc(Br)cc45)nc3c2c1 |
| InChI | InChI=1S/C23H12BrN5O4/c24-11-1-6-20-16(7-11)19(10-25-20)23-26-21-17-8-12(28(30)31)2-4-14(17)15-5-3-13(29(32)33)9-18(15)22(21)27-23/h1-10,25H,(H,26,27) |
| InChIKey | FNRJEXZPHMYTBL-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.28 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|