C24H17FN2O3 — CID 118603113
4-[2-[3-fluoro-4-(2-methylpyrimidin-5-yl)phenyl]phenoxy]benzoic acid (PubChem CID 118603113) has the molecular formula C24H17FN2O3 and a molecular weight of 400.41 g/mol. Its IUPAC name is 4-[2-[3-fluoro-4-(2-methylpyrimidin-5-yl)phenyl]phenoxy]benzoic acid.
| Compound Name | 4-[2-[3-fluoro-4-(2-methylpyrimidin-5-yl)phenyl]phenoxy]benzoic acid |
|---|---|
| PubChem CID | 118603113 |
| Molecular Formula | C24H17FN2O3 |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 4-[2-[3-fluoro-4-(2-methylpyrimidin-5-yl)phenyl]phenoxy]benzoic acid |
| SMILES | Cc1ncc(-c2ccc(-c3ccccc3Oc3ccc(C(=O)O)cc3)cc2F)cn1 |
| InChI | InChI=1S/C24H17FN2O3/c1-15-26-13-18(14-27-15)20-11-8-17(12-22(20)25)21-4-2-3-5-23(21)30-19-9-6-16(7-10-19)24(28)29/h2-14H,1H3,(H,28,29) |
| InChIKey | YODCVDONDLKVKP-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |