C10H6ClNO4 — CID 118603804
3-[(2-chloro-4-pyridinyl)oxy]-4-methoxycyclobut-3-ene-1,2-dione (PubChem CID 118603804) has the molecular formula C10H6ClNO4 and a molecular weight of 239.61 g/mol. Its IUPAC name is 3-[(2-chloro-4-pyridinyl)oxy]-4-methoxycyclobut-3-ene-1,2-dione.
| Compound Name | 3-[(2-chloro-4-pyridinyl)oxy]-4-methoxycyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 118603804 |
| Molecular Formula | C10H6ClNO4 |
| Molecular Weight | 239.61 g/mol |
| Exact Mass | 239.00 |
| IUPAC Name | 3-[(2-chloro-4-pyridinyl)oxy]-4-methoxycyclobut-3-ene-1,2-dione |
| SMILES | COc1c(Oc2ccnc(Cl)c2)c(=O)c1=O |
| InChI | InChI=1S/C10H6ClNO4/c1-15-9-7(13)8(14)10(9)16-5-2-3-12-6(11)4-5/h2-4H,1H3 |
| InChIKey | BRNBBEGJBMVPAT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.61 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|