C26H28N4O3S2 — CID 118603824
(3R)-3-methyl-5-oxo-N-[2-(2-oxobut-3-enyl)-5-piperidin-1-ylthiophen-3-yl]-1,2,3,4-tetrahydro-[1]benzothiolo[3,2-e][1,4]diazepine-9-carboxamide (PubChem CID 118603824) has the molecular formula C26H28N4O3S2 and a molecular weight of 508.67 g/mol. Its IUPAC name is (3R)-3-methyl-5-oxo-N-[2-(2-oxobut-3-enyl)-5-piperidin-1-ylthiophen-3-yl]-1,2,3,4-tetrahydro-[1]benzothiolo[3,2-e][1,4]diazepine-9-carboxamide.
| Compound Name | (3R)-3-methyl-5-oxo-N-[2-(2-oxobut-3-enyl)-5-piperidin-1-ylthiophen-3-yl]-1,2,3,4-tetrahydro-[1]benzothiolo[3,2-e][1,4]diazepine-9-carboxamide |
|---|---|
| PubChem CID | 118603824 |
| Molecular Formula | C26H28N4O3S2 |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | (3R)-3-methyl-5-oxo-N-[2-(2-oxobut-3-enyl)-5-piperidin-1-ylthiophen-3-yl]-1,2,3,4-tetrahydro-[1]benzothiolo[3,2-e][1,4]diazepine-9-carboxamide |
| SMILES | C=CC(=O)Cc1sc(N2CCCCC2)cc1NC(=O)c1ccc2sc3c(c2c1)NC[C@@H](C)NC3=O |
| InChI | InChI=1S/C26H28N4O3S2/c1-3-17(31)12-21-19(13-22(34-21)30-9-5-4-6-10-30)29-25(32)16-7-8-20-18(11-16)23-24(35-20)26(33)28-15(2)14-27-23/h3,7-8,11,13,15,27H,1,4-6,9-10,12,14H2,2H3,(H,28,33)(H,29,32)/t15-/m1/s1 |
| InChIKey | NTTHZOIKXNYCMW-OAHLLOKOSA-N |
| XLogP | 5.05 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|