C20H26N4OS — CID 118224407
N-[2,5-di(piperidin-1-yl)thiophen-3-yl]pyridine-2-carboxamide (PubChem CID 118224407) has the molecular formula C20H26N4OS and a molecular weight of 370.52 g/mol. Its IUPAC name is N-[2,5-di(piperidin-1-yl)thiophen-3-yl]pyridine-2-carboxamide.
| Compound Name | N-[2,5-di(piperidin-1-yl)thiophen-3-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 118224407 |
| Molecular Formula | C20H26N4OS |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | N-[2,5-di(piperidin-1-yl)thiophen-3-yl]pyridine-2-carboxamide |
| SMILES | O=C(Nc1cc(N2CCCCC2)sc1N1CCCCC1)c1ccccn1 |
| InChI | InChI=1S/C20H26N4OS/c25-19(16-9-3-4-10-21-16)22-17-15-18(23-11-5-1-6-12-23)26-20(17)24-13-7-2-8-14-24/h3-4,9-10,15H,1-2,5-8,11-14H2,(H,22,25) |
| InChIKey | GHFFOACTEKJGCT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |