C22H30N4O6 — CID 118604730
2-[2-[[(4aS,7S,7aR,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]amino]-2-oxoethoxy]-N-(aminomethyl)acetamide (PubChem CID 118604730) has the molecular formula C22H30N4O6 and a molecular weight of 446.50 g/mol. Its IUPAC name is 2-[2-[[(4aS,7S,7aR,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]amino]-2-oxoethoxy]-N-(aminomethyl)acetamide.
| Compound Name | 2-[2-[[(4aS,7S,7aR,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]amino]-2-oxoethoxy]-N-(aminomethyl)acetamide |
|---|---|
| PubChem CID | 118604730 |
| Molecular Formula | C22H30N4O6 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 2-[2-[[(4aS,7S,7aR,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]amino]-2-oxoethoxy]-N-(aminomethyl)acetamide |
| SMILES | CN1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@@H](NC(=O)COCC(=O)NCN)CC[C@@]3(O)C1C5 |
| InChI | InChI=1S/C22H30N4O6/c1-26-7-6-21-18-12-2-3-14(27)19(18)32-20(21)13(4-5-22(21,30)15(26)8-12)25-17(29)10-31-9-16(28)24-11-23/h2-3,13,15,20,27,30H,4-11,23H2,1H3,(H,24,28)(H,25,29)/t13-,15?,20-,21-,22+/m0/s1 |
| InChIKey | YDAGPVUTXBOSDF-JMPIQQIQSA-N |
| XLogP | -1.29 |
| TPSA | 146.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|