C26H38N2O5 — CID 69122076
tert-butyl (2R)-2-[[(4R,4aS,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]amino]-3-methylbutanoate (PubChem CID 69122076) has the molecular formula C26H38N2O5 and a molecular weight of 458.60 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[(4R,4aS,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]amino]-3-methylbutanoate.
| Compound Name | tert-butyl (2R)-2-[[(4R,4aS,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 69122076 |
| Molecular Formula | C26H38N2O5 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | tert-butyl (2R)-2-[[(4R,4aS,12bS)-4a,9-dihydroxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]amino]-3-methylbutanoate |
| SMILES | CC(C)[C@@H](NC1CC[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3C)C1O5)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H38N2O5/c1-14(2)20(23(30)33-24(3,4)5)27-16-9-10-26(31)18-13-15-7-8-17(29)21-19(15)25(26,22(16)32-21)11-12-28(18)6/h7-8,14,16,18,20,22,27,29,31H,9-13H2,1-6H3/t16?,18-,20-,22?,25+,26-/m1/s1 |
| InChIKey | RSUJJPZFMRPOQC-CSLSYGEKSA-N |
| XLogP | 2.50 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |