C30H44N2O7 — CID 69122233
ditert-butyl (2S)-2-[[(4R,4aS,12bS)-9-hydroxy-4a-methoxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]amino]butanedioate (PubChem CID 69122233) has the molecular formula C30H44N2O7 and a molecular weight of 544.69 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[[(4R,4aS,12bS)-9-hydroxy-4a-methoxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]amino]butanedioate.
| Compound Name | ditert-butyl (2S)-2-[[(4R,4aS,12bS)-9-hydroxy-4a-methoxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]amino]butanedioate |
|---|---|
| PubChem CID | 69122233 |
| Molecular Formula | C30H44N2O7 |
| Molecular Weight | 544.69 g/mol |
| Exact Mass | 544.31 |
| IUPAC Name | ditert-butyl (2S)-2-[[(4R,4aS,12bS)-9-hydroxy-4a-methoxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]amino]butanedioate |
| SMILES | CO[C@@]12CCC(N[C@@H](CC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C3Oc4c(O)ccc5c4[C@@]31CCN(C)[C@@H]2C5 |
| InChI | InChI=1S/C30H44N2O7/c1-27(2,3)38-22(34)16-19(26(35)39-28(4,5)6)31-18-11-12-30(36-8)21-15-17-9-10-20(33)24-23(17)29(30,25(18)37-24)13-14-32(21)7/h9-10,18-19,21,25,31,33H,11-16H2,1-8H3/t18?,19-,21+,25?,29-,30+/m0/s1 |
| InChIKey | VJQXWNGDKQKWBR-PACWFWBSSA-N |
| XLogP | 3.23 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.69 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |