C22H28N2O7 — CID 69122142
(2S)-2-[[(4R,4aS,12bS)-9-hydroxy-4a-methoxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]amino]butanedioic acid (PubChem CID 69122142) has the molecular formula C22H28N2O7 and a molecular weight of 432.47 g/mol. Its IUPAC name is (2S)-2-[[(4R,4aS,12bS)-9-hydroxy-4a-methoxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[(4R,4aS,12bS)-9-hydroxy-4a-methoxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]amino]butanedioic acid |
|---|---|
| PubChem CID | 69122142 |
| Molecular Formula | C22H28N2O7 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | (2S)-2-[[(4R,4aS,12bS)-9-hydroxy-4a-methoxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]amino]butanedioic acid |
| SMILES | CO[C@@]12CCC(N[C@@H](CC(=O)O)C(=O)O)C3Oc4c(O)ccc5c4[C@@]31CCN(C)[C@@H]2C5 |
| InChI | InChI=1S/C22H28N2O7/c1-24-8-7-21-17-11-3-4-14(25)18(17)31-19(21)12(23-13(20(28)29)10-16(26)27)5-6-22(21,30-2)15(24)9-11/h3-4,12-13,15,19,23,25H,5-10H2,1-2H3,(H,26,27)(H,28,29)/t12?,13-,15+,19?,21-,22+/m0/s1 |
| InChIKey | MNYBENXVWGLZEJ-ZGNUKRQYSA-N |
| XLogP | 0.72 |
| TPSA | 128.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |