C11H21N — CID 118606013
N-[(Z)-3,3-dimethyl-1,2-ditritiobut-1-enyl]-2,2-dimethyl-1-tritiopropan-1-imine (PubChem CID 118606013) has the molecular formula C11H21N and a molecular weight of 173.32 g/mol. Its IUPAC name is N-[(Z)-3,3-dimethyl-1,2-ditritiobut-1-enyl]-2,2-dimethyl-1-tritiopropan-1-imine.
| Compound Name | N-[(Z)-3,3-dimethyl-1,2-ditritiobut-1-enyl]-2,2-dimethyl-1-tritiopropan-1-imine |
|---|---|
| PubChem CID | 118606013 |
| Molecular Formula | C11H21N |
| Molecular Weight | 173.32 g/mol |
| Exact Mass | 173.19 |
| IUPAC Name | N-[(Z)-3,3-dimethyl-1,2-ditritiobut-1-enyl]-2,2-dimethyl-1-tritiopropan-1-imine |
| SMILES | [3H]C(/N=C(\[3H])C(C)(C)C)=C(\[3H])C(C)(C)C |
| InChI | InChI=1S/C11H21N/c1-10(2,3)7-8-12-9-11(4,5)6/h7-9H,1-6H3/b8-7-,12-9+/i7T,8T,9T |
| InChIKey | XFUPZLAWIFFVCN-HFZMOKDUSA-N |
| XLogP | 3.66 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|