C21H20ClN3O — CID 118606742
3-anilino-2-(2-chloro-4-pyridinyl)-6,6-dimethyl-5,7-dihydro-1H-indol-4-one (PubChem CID 118606742) has the molecular formula C21H20ClN3O and a molecular weight of 365.86 g/mol. Its IUPAC name is 3-anilino-2-(2-chloro-4-pyridinyl)-6,6-dimethyl-5,7-dihydro-1H-indol-4-one.
| Compound Name | 3-anilino-2-(2-chloro-4-pyridinyl)-6,6-dimethyl-5,7-dihydro-1H-indol-4-one |
|---|---|
| PubChem CID | 118606742 |
| Molecular Formula | C21H20ClN3O |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 3-anilino-2-(2-chloro-4-pyridinyl)-6,6-dimethyl-5,7-dihydro-1H-indol-4-one |
| SMILES | CC1(C)CC(=O)c2c([nH]c(-c3ccnc(Cl)c3)c2Nc2ccccc2)C1 |
| InChI | InChI=1S/C21H20ClN3O/c1-21(2)11-15-18(16(26)12-21)20(24-14-6-4-3-5-7-14)19(25-15)13-8-9-23-17(22)10-13/h3-10,24-25H,11-12H2,1-2H3 |
| InChIKey | QSADQDUSXGXSJJ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|