C18H20Cl2N2O — CID 118607364
N-[3-[benzyl(methyl)amino]propyl]-3,4-dichlorobenzamide (PubChem CID 118607364) has the molecular formula C18H20Cl2N2O and a molecular weight of 351.28 g/mol. Its IUPAC name is N-[3-[benzyl(methyl)amino]propyl]-3,4-dichlorobenzamide.
| Compound Name | N-[3-[benzyl(methyl)amino]propyl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 118607364 |
| Molecular Formula | C18H20Cl2N2O |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | N-[3-[benzyl(methyl)amino]propyl]-3,4-dichlorobenzamide |
| SMILES | CN(CCCNC(=O)c1ccc(Cl)c(Cl)c1)Cc1ccccc1 |
| InChI | InChI=1S/C18H20Cl2N2O/c1-22(13-14-6-3-2-4-7-14)11-5-10-21-18(23)15-8-9-16(19)17(20)12-15/h2-4,6-9,12H,5,10-11,13H2,1H3,(H,21,23) |
| InChIKey | BJMSSYYAXURYLB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|