C26H31FN4O2 — CID 118610453
2-[[2-(1-fluorocyclopropyl)-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazolin-6-yl]methylamino]ethanol (PubChem CID 118610453) has the molecular formula C26H31FN4O2 and a molecular weight of 450.56 g/mol. Its IUPAC name is 2-[[2-(1-fluorocyclopropyl)-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazolin-6-yl]methylamino]ethanol.
| Compound Name | 2-[[2-(1-fluorocyclopropyl)-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazolin-6-yl]methylamino]ethanol |
|---|---|
| PubChem CID | 118610453 |
| Molecular Formula | C26H31FN4O2 |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | 2-[[2-(1-fluorocyclopropyl)-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazolin-6-yl]methylamino]ethanol |
| SMILES | COc1ccccc1C1CCN(c2nc(C3(F)CC3)nc3ccc(CNCCO)cc23)CC1 |
| InChI | InChI=1S/C26H31FN4O2/c1-33-23-5-3-2-4-20(23)19-8-13-31(14-9-19)24-21-16-18(17-28-12-15-32)6-7-22(21)29-25(30-24)26(27)10-11-26/h2-7,16,19,28,32H,8-15,17H2,1H3 |
| InChIKey | BWVZUQHHTSHHCX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|