C25H26N4O — CID 118610376
2-(2-cyclopropylethynyl)-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazolin-6-amine (PubChem CID 118610376) has the molecular formula C25H26N4O and a molecular weight of 398.51 g/mol. Its IUPAC name is 2-(2-cyclopropylethynyl)-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazolin-6-amine.
| Compound Name | 2-(2-cyclopropylethynyl)-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazolin-6-amine |
|---|---|
| PubChem CID | 118610376 |
| Molecular Formula | C25H26N4O |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 2-(2-cyclopropylethynyl)-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazolin-6-amine |
| SMILES | COc1ccccc1C1CCN(c2nc(C#CC3CC3)nc3ccc(N)cc23)CC1 |
| InChI | InChI=1S/C25H26N4O/c1-30-23-5-3-2-4-20(23)18-12-14-29(15-13-18)25-21-16-19(26)9-10-22(21)27-24(28-25)11-8-17-6-7-17/h2-5,9-10,16-18H,6-7,12-15,26H2,1H3 |
| InChIKey | FBRZCGCVFAHABT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|