C26H30N4O2 — CID 144986141
2-[[2-cyclopropyl-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazolin-6-yl]-methylamino]acetaldehyde (PubChem CID 144986141) has the molecular formula C26H30N4O2 and a molecular weight of 430.55 g/mol. Its IUPAC name is 2-[[2-cyclopropyl-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazolin-6-yl]-methylamino]acetaldehyde.
| Compound Name | 2-[[2-cyclopropyl-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazolin-6-yl]-methylamino]acetaldehyde |
|---|---|
| PubChem CID | 144986141 |
| Molecular Formula | C26H30N4O2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 2-[[2-cyclopropyl-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazolin-6-yl]-methylamino]acetaldehyde |
| SMILES | COc1ccccc1C1CCN(c2nc(C3CC3)nc3ccc(N(C)CC=O)cc23)CC1 |
| InChI | InChI=1S/C26H30N4O2/c1-29(15-16-31)20-9-10-23-22(17-20)26(28-25(27-23)19-7-8-19)30-13-11-18(12-14-30)21-5-3-4-6-24(21)32-2/h3-6,9-10,16-19H,7-8,11-15H2,1-2H3 |
| InChIKey | NBJMWQCVANGODC-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|