C27H33N5O — CID 130356430
[[4-[4-[2-(azetidin-1-yl)phenyl]piperidin-1-yl]-2-cyclopropylquinazolin-6-yl]-methylamino]methanol (PubChem CID 130356430) has the molecular formula C27H33N5O and a molecular weight of 443.60 g/mol. Its IUPAC name is [[4-[4-[2-(azetidin-1-yl)phenyl]piperidin-1-yl]-2-cyclopropylquinazolin-6-yl]-methylamino]methanol.
| Compound Name | [[4-[4-[2-(azetidin-1-yl)phenyl]piperidin-1-yl]-2-cyclopropylquinazolin-6-yl]-methylamino]methanol |
|---|---|
| PubChem CID | 130356430 |
| Molecular Formula | C27H33N5O |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | [[4-[4-[2-(azetidin-1-yl)phenyl]piperidin-1-yl]-2-cyclopropylquinazolin-6-yl]-methylamino]methanol |
| SMILES | CN(CO)c1ccc2nc(C3CC3)nc(N3CCC(c4ccccc4N4CCC4)CC3)c2c1 |
| InChI | InChI=1S/C27H33N5O/c1-30(18-33)21-9-10-24-23(17-21)27(29-26(28-24)20-7-8-20)32-15-11-19(12-16-32)22-5-2-3-6-25(22)31-13-4-14-31/h2-3,5-6,9-10,17,19-20,33H,4,7-8,11-16,18H2,1H3 |
| InChIKey | OBTLIHHEJJGMDE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|