C28H38N4O — CID 118617784
2-butan-2-yl-4-[4-(2-methoxyphenyl)piperidin-1-yl]-N-methyl-N-propylquinazolin-6-amine (PubChem CID 118617784) has the molecular formula C28H38N4O and a molecular weight of 446.64 g/mol. Its IUPAC name is 2-butan-2-yl-4-[4-(2-methoxyphenyl)piperidin-1-yl]-N-methyl-N-propylquinazolin-6-amine.
| Compound Name | 2-butan-2-yl-4-[4-(2-methoxyphenyl)piperidin-1-yl]-N-methyl-N-propylquinazolin-6-amine |
|---|---|
| PubChem CID | 118617784 |
| Molecular Formula | C28H38N4O |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | 2-butan-2-yl-4-[4-(2-methoxyphenyl)piperidin-1-yl]-N-methyl-N-propylquinazolin-6-amine |
| SMILES | CCCN(C)c1ccc2nc(C(C)CC)nc(N3CCC(c4ccccc4OC)CC3)c2c1 |
| InChI | InChI=1S/C28H38N4O/c1-6-16-31(4)22-12-13-25-24(19-22)28(30-27(29-25)20(3)7-2)32-17-14-21(15-18-32)23-10-8-9-11-26(23)33-5/h8-13,19-21H,6-7,14-18H2,1-5H3 |
| InChIKey | XWGKKWOIGJVDKJ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |