C27H33FN4O3 — CID 163927970
2-[[2-(4-fluorobutyl)-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazolin-6-yl]-methylamino]acetic acid (PubChem CID 163927970) has the molecular formula C27H33FN4O3 and a molecular weight of 480.58 g/mol. Its IUPAC name is 2-[[2-(4-fluorobutyl)-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazolin-6-yl]-methylamino]acetic acid.
| Compound Name | 2-[[2-(4-fluorobutyl)-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazolin-6-yl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 163927970 |
| Molecular Formula | C27H33FN4O3 |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | 2-[[2-(4-fluorobutyl)-4-[4-(2-methoxyphenyl)piperidin-1-yl]quinazolin-6-yl]-methylamino]acetic acid |
| SMILES | COc1ccccc1C1CCN(c2nc(CCCCF)nc3ccc(N(C)CC(=O)O)cc23)CC1 |
| InChI | InChI=1S/C27H33FN4O3/c1-31(18-26(33)34)20-10-11-23-22(17-20)27(30-25(29-23)9-5-6-14-28)32-15-12-19(13-16-32)21-7-3-4-8-24(21)35-2/h3-4,7-8,10-11,17,19H,5-6,9,12-16,18H2,1-2H3,(H,33,34) |
| InChIKey | RGDRPRJACWVLIM-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|