C18H14N4O2S — CID 118611347
5-(benzenesulfonyl)-7-phenylpyrrolo[2,3-c]pyridazin-6-amine (PubChem CID 118611347) has the molecular formula C18H14N4O2S and a molecular weight of 350.40 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-7-phenylpyrrolo[2,3-c]pyridazin-6-amine.
| Compound Name | 5-(benzenesulfonyl)-7-phenylpyrrolo[2,3-c]pyridazin-6-amine |
|---|---|
| PubChem CID | 118611347 |
| Molecular Formula | C18H14N4O2S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 5-(benzenesulfonyl)-7-phenylpyrrolo[2,3-c]pyridazin-6-amine |
| SMILES | Nc1c(S(=O)(=O)c2ccccc2)c2ccnnc2n1-c1ccccc1 |
| InChI | InChI=1S/C18H14N4O2S/c19-17-16(25(23,24)14-9-5-2-6-10-14)15-11-12-20-21-18(15)22(17)13-7-3-1-4-8-13/h1-12H,19H2 |
| InChIKey | FJYMOCSUMORLPF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |