C21H23F5N4O4S — CID 118614372
(2R,3S,5R,6S)-2-(2,5-difluorophenyl)-5-[3-methyl-2-(oxetan-3-ylsulfonyl)-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]-6-(trifluoromethyl)oxan-3-amine (PubChem CID 118614372) has the molecular formula C21H23F5N4O4S and a molecular weight of 522.50 g/mol. Its IUPAC name is (2R,3S,5R,6S)-2-(2,5-difluorophenyl)-5-[3-methyl-2-(oxetan-3-ylsulfonyl)-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]-6-(trifluoromethyl)oxan-3-amine.
| Compound Name | (2R,3S,5R,6S)-2-(2,5-difluorophenyl)-5-[3-methyl-2-(oxetan-3-ylsulfonyl)-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]-6-(trifluoromethyl)oxan-3-amine |
|---|---|
| PubChem CID | 118614372 |
| Molecular Formula | C21H23F5N4O4S |
| Molecular Weight | 522.50 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | (2R,3S,5R,6S)-2-(2,5-difluorophenyl)-5-[3-methyl-2-(oxetan-3-ylsulfonyl)-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]-6-(trifluoromethyl)oxan-3-amine |
| SMILES | Cc1c2c(nn1S(=O)(=O)C1COC1)CN([C@@H]1C[C@H](N)[C@@H](c3cc(F)ccc3F)O[C@@H]1C(F)(F)F)C2 |
| InChI | InChI=1S/C21H23F5N4O4S/c1-10-14-6-29(7-17(14)28-30(10)35(31,32)12-8-33-9-12)18-5-16(27)19(34-20(18)21(24,25)26)13-4-11(22)2-3-15(13)23/h2-4,12,16,18-20H,5-9,27H2,1H3/t16-,18+,19+,20-/m0/s1 |
| InChIKey | NYDXWPGGVHQHBR-NBYUQASBSA-N |
| XLogP | 2.15 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.50 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |