C21H23F5N4O4S — CID 129048622
(2R,3S,5R,6S)-2-(2,5-difluorophenyl)-5-[2-[(3R)-oxolan-3-yl]sulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]-6-(trifluoromethyl)oxan-3-amine (PubChem CID 129048622) has the molecular formula C21H23F5N4O4S and a molecular weight of 522.50 g/mol. Its IUPAC name is (2R,3S,5R,6S)-2-(2,5-difluorophenyl)-5-[2-[(3R)-oxolan-3-yl]sulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]-6-(trifluoromethyl)oxan-3-amine.
| Compound Name | (2R,3S,5R,6S)-2-(2,5-difluorophenyl)-5-[2-[(3R)-oxolan-3-yl]sulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]-6-(trifluoromethyl)oxan-3-amine |
|---|---|
| PubChem CID | 129048622 |
| Molecular Formula | C21H23F5N4O4S |
| Molecular Weight | 522.50 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | (2R,3S,5R,6S)-2-(2,5-difluorophenyl)-5-[2-[(3R)-oxolan-3-yl]sulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl]-6-(trifluoromethyl)oxan-3-amine |
| SMILES | N[C@H]1C[C@@H](N2Cc3cn(S(=O)(=O)[C@@H]4CCOC4)nc3C2)[C@@H](C(F)(F)F)O[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C21H23F5N4O4S/c22-12-1-2-15(23)14(5-12)19-16(27)6-18(20(34-19)21(24,25)26)29-7-11-8-30(28-17(11)9-29)35(31,32)13-3-4-33-10-13/h1-2,5,8,13,16,18-20H,3-4,6-7,9-10,27H2/t13-,16+,18-,19-,20+/m1/s1 |
| InChIKey | DKTOHAOQDJRKGL-MKCULMFZSA-N |
| XLogP | 2.23 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |