C21H28O10 — CID 118614817
[(3S,3aR,4S,6S,6aR,7S,9bS)-6-acetyloxy-3,3a,7-trihydroxy-3,6,9-trimethyl-2,8-dioxo-5,6a,7,9b-tetrahydro-4H-azuleno[4,5-b]furan-4-yl] butanoate (PubChem CID 118614817) has the molecular formula C21H28O10 and a molecular weight of 440.45 g/mol. Its IUPAC name is [(3S,3aR,4S,6S,6aR,7S,9bS)-6-acetyloxy-3,3a,7-trihydroxy-3,6,9-trimethyl-2,8-dioxo-5,6a,7,9b-tetrahydro-4H-azuleno[4,5-b]furan-4-yl] butanoate.
| Compound Name | [(3S,3aR,4S,6S,6aR,7S,9bS)-6-acetyloxy-3,3a,7-trihydroxy-3,6,9-trimethyl-2,8-dioxo-5,6a,7,9b-tetrahydro-4H-azuleno[4,5-b]furan-4-yl] butanoate |
|---|---|
| PubChem CID | 118614817 |
| Molecular Formula | C21H28O10 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | [(3S,3aR,4S,6S,6aR,7S,9bS)-6-acetyloxy-3,3a,7-trihydroxy-3,6,9-trimethyl-2,8-dioxo-5,6a,7,9b-tetrahydro-4H-azuleno[4,5-b]furan-4-yl] butanoate |
| SMILES | CCCC(=O)O[C@H]1C[C@](C)(OC(C)=O)[C@@H]2C(=C(C)C(=O)[C@H]2O)[C@@H]2OC(=O)[C@@](C)(O)[C@@]12O |
| InChI | InChI=1S/C21H28O10/c1-6-7-12(23)29-11-8-19(4,31-10(3)22)14-13(9(2)15(24)16(14)25)17-21(11,28)20(5,27)18(26)30-17/h11,14,16-17,25,27-28H,6-8H2,1-5H3/t11-,14+,16-,17-,19-,20+,21+/m0/s1 |
| InChIKey | BMMBETVHTOZZRX-IAZPPFERSA-N |
| XLogP | -0.29 |
| TPSA | 156.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|