C23H19ClF2N4O5S — CID 118616762
N-[5-(3-chloro-4-oxopyrido[1,2-a]pyrimidin-7-yl)-2-(3-methoxypropoxy)-3-pyridinyl]-2,4-difluorobenzenesulfonamide (PubChem CID 118616762) has the molecular formula C23H19ClF2N4O5S and a molecular weight of 536.94 g/mol. Its IUPAC name is N-[5-(3-chloro-4-oxopyrido[1,2-a]pyrimidin-7-yl)-2-(3-methoxypropoxy)-3-pyridinyl]-2,4-difluorobenzenesulfonamide.
| Compound Name | N-[5-(3-chloro-4-oxopyrido[1,2-a]pyrimidin-7-yl)-2-(3-methoxypropoxy)-3-pyridinyl]-2,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 118616762 |
| Molecular Formula | C23H19ClF2N4O5S |
| Molecular Weight | 536.94 g/mol |
| Exact Mass | 536.07 |
| IUPAC Name | N-[5-(3-chloro-4-oxopyrido[1,2-a]pyrimidin-7-yl)-2-(3-methoxypropoxy)-3-pyridinyl]-2,4-difluorobenzenesulfonamide |
| SMILES | COCCCOc1ncc(-c2ccc3ncc(Cl)c(=O)n3c2)cc1NS(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C23H19ClF2N4O5S/c1-34-7-2-8-35-22-19(29-36(32,33)20-5-4-16(25)10-18(20)26)9-15(11-28-22)14-3-6-21-27-12-17(24)23(31)30(21)13-14/h3-6,9-13,29H,2,7-8H2,1H3 |
| InChIKey | WLIWHLYKGGPMOC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.94 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|