C19H13F2IN4O3S — CID 86718346
2,4-difluoro-N-[5-(3-iodoimidazo[1,2-a]pyridin-6-yl)-2-methoxy-3-pyridinyl]benzenesulfonamide (PubChem CID 86718346) has the molecular formula C19H13F2IN4O3S and a molecular weight of 542.31 g/mol. Its IUPAC name is 2,4-difluoro-N-[5-(3-iodoimidazo[1,2-a]pyridin-6-yl)-2-methoxy-3-pyridinyl]benzenesulfonamide.
| Compound Name | 2,4-difluoro-N-[5-(3-iodoimidazo[1,2-a]pyridin-6-yl)-2-methoxy-3-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 86718346 |
| Molecular Formula | C19H13F2IN4O3S |
| Molecular Weight | 542.31 g/mol |
| Exact Mass | 541.97 |
| IUPAC Name | 2,4-difluoro-N-[5-(3-iodoimidazo[1,2-a]pyridin-6-yl)-2-methoxy-3-pyridinyl]benzenesulfonamide |
| SMILES | COc1ncc(-c2ccc3ncc(I)n3c2)cc1NS(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H13F2IN4O3S/c1-29-19-15(25-30(27,28)16-4-3-13(20)7-14(16)21)6-12(8-24-19)11-2-5-18-23-9-17(22)26(18)10-11/h2-10,25H,1H3 |
| InChIKey | HQIXFESNZSMEHK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.31 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|