C27H28FN3O2 — CID 118619965
5-[[1-(cyclopropanecarbonyl)piperidin-4-yl]methyl]-6-[4-(4-fluorophenyl)phenyl]-1,2-diazaspiro[2.4]hept-6-en-4-one (PubChem CID 118619965) has the molecular formula C27H28FN3O2 and a molecular weight of 445.54 g/mol. Its IUPAC name is 5-[[1-(cyclopropanecarbonyl)piperidin-4-yl]methyl]-6-[4-(4-fluorophenyl)phenyl]-1,2-diazaspiro[2.4]hept-6-en-4-one.
| Compound Name | 5-[[1-(cyclopropanecarbonyl)piperidin-4-yl]methyl]-6-[4-(4-fluorophenyl)phenyl]-1,2-diazaspiro[2.4]hept-6-en-4-one |
|---|---|
| PubChem CID | 118619965 |
| Molecular Formula | C27H28FN3O2 |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 5-[[1-(cyclopropanecarbonyl)piperidin-4-yl]methyl]-6-[4-(4-fluorophenyl)phenyl]-1,2-diazaspiro[2.4]hept-6-en-4-one |
| SMILES | O=C(C1CC1)N1CCC(CC2C(=O)C3(C=C2c2ccc(-c4ccc(F)cc4)cc2)NN3)CC1 |
| InChI | InChI=1S/C27H28FN3O2/c28-22-9-7-19(8-10-22)18-1-3-20(4-2-18)24-16-27(29-30-27)25(32)23(24)15-17-11-13-31(14-12-17)26(33)21-5-6-21/h1-4,7-10,16-17,21,23,29-30H,5-6,11-15H2 |
| InChIKey | MFJYWSHSBGFSNC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|