C17H23FN2O2 — CID 124699739
[(1R,3R)-3-aminocyclopentyl]-[4-(4-fluorophenoxy)piperidin-1-yl]methanone (PubChem CID 124699739) has the molecular formula C17H23FN2O2 and a molecular weight of 306.38 g/mol. Its IUPAC name is [(1R,3R)-3-aminocyclopentyl]-[4-(4-fluorophenoxy)piperidin-1-yl]methanone.
| Compound Name | [(1R,3R)-3-aminocyclopentyl]-[4-(4-fluorophenoxy)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 124699739 |
| Molecular Formula | C17H23FN2O2 |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | [(1R,3R)-3-aminocyclopentyl]-[4-(4-fluorophenoxy)piperidin-1-yl]methanone |
| SMILES | N[C@@H]1CC[C@@H](C(=O)N2CCC(Oc3ccc(F)cc3)CC2)C1 |
| InChI | InChI=1S/C17H23FN2O2/c18-13-2-5-15(6-3-13)22-16-7-9-20(10-8-16)17(21)12-1-4-14(19)11-12/h2-3,5-6,12,14,16H,1,4,7-11,19H2/t12-,14-/m1/s1 |
| InChIKey | SFOMPQMTKMIVHO-TZMCWYRMSA-N |
| XLogP | 2.32 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |