C16H20Cl2N2O2 — CID 119815606
(3-aminocyclopentyl)-[3-(3,4-dichlorophenoxy)pyrrolidin-1-yl]methanone (PubChem CID 119815606) has the molecular formula C16H20Cl2N2O2 and a molecular weight of 343.25 g/mol. Its IUPAC name is (3-aminocyclopentyl)-[3-(3,4-dichlorophenoxy)pyrrolidin-1-yl]methanone.
| Compound Name | (3-aminocyclopentyl)-[3-(3,4-dichlorophenoxy)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 119815606 |
| Molecular Formula | C16H20Cl2N2O2 |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | (3-aminocyclopentyl)-[3-(3,4-dichlorophenoxy)pyrrolidin-1-yl]methanone |
| SMILES | NC1CCC(C(=O)N2CCC(Oc3ccc(Cl)c(Cl)c3)C2)C1 |
| InChI | InChI=1S/C16H20Cl2N2O2/c17-14-4-3-12(8-15(14)18)22-13-5-6-20(9-13)16(21)10-1-2-11(19)7-10/h3-4,8,10-11,13H,1-2,5-7,9,19H2 |
| InChIKey | UILKBIIYFXWANY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |