C18H25ClFN3O2 — CID 119710030
(3-aminocyclohexyl)-[4-(4-fluorobenzoyl)piperazin-1-yl]methanone;hydrochloride (PubChem CID 119710030) has the molecular formula C18H25ClFN3O2 and a molecular weight of 369.87 g/mol. Its IUPAC name is (3-aminocyclohexyl)-[4-(4-fluorobenzoyl)piperazin-1-yl]methanone;hydrochloride.
| Compound Name | (3-aminocyclohexyl)-[4-(4-fluorobenzoyl)piperazin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119710030 |
| Molecular Formula | C18H25ClFN3O2 |
| Molecular Weight | 369.87 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | (3-aminocyclohexyl)-[4-(4-fluorobenzoyl)piperazin-1-yl]methanone;hydrochloride |
| SMILES | Cl.NC1CCCC(C(=O)N2CCN(C(=O)c3ccc(F)cc3)CC2)C1 |
| InChI | InChI=1S/C18H24FN3O2.ClH/c19-15-6-4-13(5-7-15)17(23)21-8-10-22(11-9-21)18(24)14-2-1-3-16(20)12-14;/h4-7,14,16H,1-3,8-12,20H2;1H |
| InChIKey | ZIPCIRVITFGACK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.87 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |