C23H18Cl2N2O2 — CID 118622915
(2E,5R,6S)-5,6-bis(4-chlorophenyl)-4-methyl-2-(pyridin-3-ylmethylidene)morpholin-3-one (PubChem CID 118622915) has the molecular formula C23H18Cl2N2O2 and a molecular weight of 425.32 g/mol. Its IUPAC name is (2E,5R,6S)-5,6-bis(4-chlorophenyl)-4-methyl-2-(pyridin-3-ylmethylidene)morpholin-3-one.
| Compound Name | (2E,5R,6S)-5,6-bis(4-chlorophenyl)-4-methyl-2-(pyridin-3-ylmethylidene)morpholin-3-one |
|---|---|
| PubChem CID | 118622915 |
| Molecular Formula | C23H18Cl2N2O2 |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | (2E,5R,6S)-5,6-bis(4-chlorophenyl)-4-methyl-2-(pyridin-3-ylmethylidene)morpholin-3-one |
| SMILES | CN1C(=O)/C(=C\c2cccnc2)O[C@@H](c2ccc(Cl)cc2)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H18Cl2N2O2/c1-27-21(16-4-8-18(24)9-5-16)22(17-6-10-19(25)11-7-17)29-20(23(27)28)13-15-3-2-12-26-14-15/h2-14,21-22H,1H3/b20-13+/t21-,22+/m1/s1 |
| InChIKey | XLGVHHSVXOPPOL-MJVJYZJNSA-N |
| XLogP | 5.70 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|