C37H30N6O4 — CID 118623175
(E)-2-cyano-3-[3-[[1-[(4-methoxyphenyl)methyl]-4-(4-phenoxyphenoxy)pyrazolo[3,4-b]pyridin-3-yl]amino]phenyl]-N-methylprop-2-enamide (PubChem CID 118623175) has the molecular formula C37H30N6O4 and a molecular weight of 622.69 g/mol. Its IUPAC name is (E)-2-cyano-3-[3-[[1-[(4-methoxyphenyl)methyl]-4-(4-phenoxyphenoxy)pyrazolo[3,4-b]pyridin-3-yl]amino]phenyl]-N-methylprop-2-enamide.
| Compound Name | (E)-2-cyano-3-[3-[[1-[(4-methoxyphenyl)methyl]-4-(4-phenoxyphenoxy)pyrazolo[3,4-b]pyridin-3-yl]amino]phenyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 118623175 |
| Molecular Formula | C37H30N6O4 |
| Molecular Weight | 622.69 g/mol |
| Exact Mass | 622.23 |
| IUPAC Name | (E)-2-cyano-3-[3-[[1-[(4-methoxyphenyl)methyl]-4-(4-phenoxyphenoxy)pyrazolo[3,4-b]pyridin-3-yl]amino]phenyl]-N-methylprop-2-enamide |
| SMILES | CNC(=O)/C(C#N)=C/c1cccc(Nc2nn(Cc3ccc(OC)cc3)c3nccc(Oc4ccc(Oc5ccccc5)cc4)c23)c1 |
| InChI | InChI=1S/C37H30N6O4/c1-39-37(44)27(23-38)21-26-7-6-8-28(22-26)41-35-34-33(47-32-17-15-31(16-18-32)46-30-9-4-3-5-10-30)19-20-40-36(34)43(42-35)24-25-11-13-29(45-2)14-12-25/h3-22H,24H2,1-2H3,(H,39,44)(H,41,42)/b27-21+ |
| InChIKey | GMDGJIDPZQWDHZ-SZXQPVLSSA-N |
| XLogP | 7.47 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.69 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|